Home
Products
Chicanine
| Product Name | Chicanine |
| Price: | $409 / 5mg |
| Catalog No.: | CN02702 |
| CAS No.: | 78919-28-5 |
| Molecular Formula: | C20H22O5 |
| Molecular Weight: | 342.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Osmanthus fragrans. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)[C@@H]1O[C@H]([C@@H]([C@@H]1C)C)c1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chicanine is a lignan compound of Schisandra chinesis, inhibits LPS-induced phosphorylation of p38 MAPK, ERK 1/2 and IκB-α, with anti-inflammatory activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 483.8±45.0 °C at 760 mmHg |
| Flash Point | 246.4±28.7 °C |
| Exact Mass | 342.146729 |
| PSA | 57.15000 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |