Home
Products
Deapi-platycodin D
| Product Name | Deapi-platycodin D |
| Price: | $176 / 10mg |
| Catalog No.: | CN07735 |
| CAS No.: | 78763-58-3 |
| Molecular Formula: | C52H84O24 |
| Molecular Weight: | 1093.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Platycodon grandiflorum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)C[C@]3([C@H](C2(CO)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deapioplatycodin D is a triterpenoid saponin isolated from Platycodon grandiflorum, with anti-HCV activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1092.535278 |
| PSA | 394.36000 |
| LogP | -0.39 |