Home
Products
Plantagoside
| Product Name | Plantagoside |
| Price: | $77 / 10mg |
| Catalog No.: | CN04585 |
| CAS No.: | 78708-33-5 |
| Molecular Formula: | C21H22O12 |
| Molecular Weight: | 466.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Plantago asiatica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(cc(c2O)O)[C@@H]2CC(=O)c3c(O2)cc(cc3O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Plantagoside, isolated from the seeds of Plantago asiatica, is a specific and non-competitive inhibitor for jack bean α-mannosidase, with an IC50 of 5 μM[1]. |
| Density | 1.735 |
| Boiling Point | 868.6±65.0 °C at 760 mmHg |
| Flash Point | 305.2±27.8 °C |
| Exact Mass | 466.111115 |
| PSA | 206.60000 |
| LogP | -0.33 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |