Home
Products
Dehydroandrographolide succinate
| Product Name | Dehydroandrographolide succinate |
| Price: | $54 / 20mg |
| Catalog No.: | CN08227 |
| CAS No.: | 786593-06-4 |
| Molecular Formula: | C28H36O10 |
| Molecular Weight: | 532.59 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Andrographis paniculata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(OCC1(C)C(CCC2(C1CCC(=C)C2C=CC1=CCOC1=O)C)OC(=O)CCC(=O)O)CCC(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydroandrographolide succinate, extracted from herbal medicine Andrographis paniculata (Burm f) Nees, is widely used for the treatment of viral pneumonia and viral upper respiratory tract infections because of its immunostimulatory, anti-infective and anti-inflammatory effect[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 733.8±60.0 °C at 760 mmHg |
| Flash Point | 239.1±26.4 °C |
| Exact Mass | 532.230835 |
| PSA | 153.50000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |