Home
Products
7-Epi-10-deacetyltaxol
| Product Name | 7-Epi-10-deacetyltaxol |
| Price: | $89 / 20mg |
| Catalog No.: | CN08288 |
| CAS No.: | 78454-17-8 |
| Molecular Formula: | C45H49NO13 |
| Molecular Weight: | 811.86 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Taxus wallichiana. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@]12CO[C@@H]1C[C@H]([C@@]1([C@@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](OC(=O)[C@@H]([C@H](c3ccccc3)/N=C(/c3ccccc3)O)O)C(=C(C2(C)C)[C@H](C1=O)O)C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Epi 10-desacetyl paclitaxel (7-epi-10-deacetyltaxol), a taxol derivative, exhibits cytotoxicity against HeLa cells with an IC50 of 85 μM[1][2]. |
| Density | 1.41±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 959.5℃ at 760 mmHg |
| Exact Mass | 811.32000 |
| PSA | 218.71000 |
| LogP | 3.73970 |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |