Home
Products
Deacetyltaxol
| Product Name | Deacetyltaxol |
| Price: | Inquiry |
| Catalog No.: | CN08509 |
| CAS No.: | 78432-77-6 |
| Molecular Formula: | C45H49NO13 |
| Molecular Weight: | 811.87 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Taxus chinensis (Pilger) Rehd. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@]12CO[C@@H]1C[C@@H]([C@@]1([C@@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](OC(=O)[C@@H]([C@H](c3ccccc3)NC(=O)c3ccccc3)O)C(=C(C2(C)C)[C@H](C1=O)O)C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 10-Deacetyltaxol (10-Deacetylpaclitaxel) is a taxane derivative isolated from Taxus wallichiana Zucc[1]. 10-Deacetyltaxol (10-Deacetylpaclitaxel) promotes the polymerization of tubulin and to inhibit the depolymerization of microtubules induced by cold or by calcium ions in vitro[2]. 10-Deacetyltaxol (10-Deacetylpaclitaxel) exhibits cytotoxicity in human glial and neuroblastoma cell-lines[3]. |
| Target | tubulin[2] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 959.5±65.0 °C at 760 mmHg |
| Flash Point | 534.1±34.3 °C |
| Exact Mass | 811.320374 |
| PSA | 215.22000 |
| LogP | 6.74 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20°C Freezer |