Home
Products
5,7,3'-Trihydroxy-6,4',5'-trimethoxyflavone
| Product Name | 5,7,3'-Trihydroxy-6,4',5'-trimethoxyflavone |
| Price: | $234 / 10mg |
| Catalog No.: | CN04831 |
| CAS No.: | 78417-26-2 |
| Molecular Formula: | C18H16O8 |
| Molecular Weight: | 360.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Artemisia argyi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc(cc1OC)c1cc(=O)c2c(o1)cc(c(c2O)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7,3'-Trihydroxy-6,4',5'-trimethoxyflavone is a methylated flavones from Artemisia frigida. |
| Density | 1.461±0.06 g/cm3(Predicted) |
| Boiling Point | 646.1±55.0 °C(Predicted) |
| Exact Mass | 360.08500 |
| PSA | 118.59000 |
| LogP | 2.60260 |