Home
Products
Ecliptasaponin A
| Product Name | Ecliptasaponin A |
| Price: | $112 / 20mg |
| Catalog No.: | CN07513 |
| CAS No.: | 78285-90-2 |
| Molecular Formula: | C36H58O9 |
| Molecular Weight: | 634.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Eclipta prostrata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@@H]3CC(C)(C)CC2)C(=O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ecliptasaponin A , a pentacyclic triterpenoid saponin, is one of major compounds separated from Eclipta prostrate[1]. Eclipta prostrate is considered as a nourishing herbal medicine with pleiotropic effects, including anti-inflammatory, hepatoprotective, antioxidant, and immunomodulatory[2]. |
| Density | 1.27±0.1 g/cm3 |
| Boiling Point | 752.6±60.0 °C at 760 mmHg |
| Flash Point | 228.6±26.4 °C |
| Exact Mass | 634.408081 |
| PSA | 156.91000 |
| LogP | 5.61 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |
| Storage condition | 2-8°C |