Home
Products
(-)-Toddanol
| Product Name | (-)-Toddanol |
| Price: | Inquiry |
| Catalog No.: | CN06187 |
| CAS No.: | 77715-99-2 |
| Molecular Formula: | C16H18O5 |
| Molecular Weight: | 290.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Cryst. |
| Source: | The roots of Toddalia asiatica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(=O)ccc2c(c1C[C@@H](C(=C)C)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Toddanol, a coumarin, can be isolated from the root of Toddalia asiatica[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 480.4±45.0 °C at 760 mmHg |
| Flash Point | 177.4±22.2 °C |
| Exact Mass | 290.115417 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |