Home
Products
Ingenol-3,4:5,20-diacetonide
| Product Name | Ingenol-3,4:5,20-diacetonide |
| Price: | Inquiry |
| Catalog No.: | CN08498 |
| CAS No.: | 77573-44-5 |
| Molecular Formula: | C26H36O5 |
| Molecular Weight: | 428.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@]23C4(C1OC(O4)(C)C)C1OC(C)(C)OCC1=C[C@@H](C3=O)[C@@H]1[C@H](CC2C)C1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ingenol-3,4,5,20-diacetonide is a natural compound. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 521.0±50.0 °C at 760 mmHg |
| Flash Point | 222.9±30.2 °C |
| Exact Mass | 428.256287 |
| PSA | 53.99000 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8℃ |