Home
Products
Abyssinone V
| Product Name | Abyssinone V |
| Price: | Inquiry |
| Catalog No.: | CN04724 |
| CAS No.: | 77263-11-7 |
| Molecular Formula: | C25H28O5 |
| Molecular Weight: | 408.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The root bark of Erythrina mildbraedii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc(cc(c1O)CC=C(C)C)C1CC(=O)c2c(O1)cc(cc2O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Abyssinone V is a prenylated flavonoid with predicted anti-viral activity. Abyssinone V can be isolated from the stem bark of Erythrina melanacantha. Abyssinone V possesses good pharmacodynamics properties. Abyssinone V is predicted to be antivirals including anti-herpes (HSV) agent, with mechanisms comprising inhibition of polymerase, ATPase and membrane integrity[1][2]. |
| Density | 1.22g/cm3 |
| Boiling Point | 619.8ºC at 760 mmHg |
| Flash Point | 210.8ºC |
| Exact Mass | 408.19400 |
| PSA | 86.99000 |
| LogP | 5.52730 |