Home
Products
Carboxyatractyloside
| Product Name | Carboxyatractyloside |
| Price: | $62 / 10mg |
| Catalog No.: | CN08503 |
| CAS No.: | 77228-71-8 |
| Molecular Formula: | C31H43K3O18S2 |
| Molecular Weight: | 885.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Atractylodes lancea (Thunb.) DC. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CC(C(=O)O)(C(=O)O)C3C(C2)(C)C2CCC4CC2(CC3)C(O)C4=C)C(C(C1OS(=O)(=O)O)OS(=O)(=O)O)OC(=O)CC(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Carboxyatractyloside is a toxic natural product, acts as an inhibitor of ADP/ATP carrier, inhibits mitochondrial ADP/ATP transport[1]. |
| Density | 1.58±0.1 g/cm3 |
| Exact Mass | 770.212585 |
| PSA | 312.27000 |
| LogP | 3.16 |
| Storage condition | 2-8℃ |