Home
Products
Hypocrellin A
| Product Name | Hypocrellin A |
| Price: | $77 / 10mg |
| Catalog No.: | CN05970 |
| CAS No.: | 77029-83-5 |
| Molecular Formula: | C30H26O10 |
| Molecular Weight: | 546.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | From Hypocrella bambusae |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)c2C(=O)C=C(c3c2c2c1CC(C)(O)C(c1c2c2c3C(=CC(=O)c2c(c1OC)O)OC)C(=O)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypocrellin A, a naturally occurring PKC inhibitor, has many biological and pharmacological properties, such as antitumour, antiviral, antibacterial, and antileishmanial activities. Hypocrellin A is a promising photosensitizer for anticancer photodynamic therapy (PDT)[1][2][3][4]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 894.0±65.0 °C at 760 mmHg |
| Flash Point | 299.6±27.8 °C |
| Exact Mass | 546.152588 |
| PSA | 148.82000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |