Home
Products
Dehydropachymic acid
| Product Name | Dehydropachymic acid |
| Price: | $467 / 10mg |
| Catalog No.: | CN07606 |
| CAS No.: | 77012-31-8 |
| Molecular Formula: | C33H50O5 |
| Molecular Weight: | 526.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Wolfiporia cocos (Schw.) Ryv. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC=C1C2=CC[C@]2([C@@]1(C)C[C@H]([C@@H]2[C@H](C(=O)O)CCC(=C)C(C)C)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydropachymic acid is one of the major triterpenes isolated from Poria cocos. Dehydropachymic acid is more effective in autophagy-lysosome pathway (ALP) impaired cells rather than normal cells[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 629.3±55.0 °C at 760 mmHg |
| Flash Point | 192.1±25.0 °C |
| Exact Mass | 526.365845 |
| LogP | 8.16 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Storage condition | 2-8℃ |