Home
Products
D-(-)-Quinic acid
| Product Name | D-(-)-Quinic acid |
| Price: | $18 / 20mg |
| Catalog No.: | CN06702 |
| CAS No.: | 77-95-2 |
| Molecular Formula: | C7H12O6 |
| Molecular Weight: | 192.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus limon (L.) Burm. f. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@H](O)C[C@@](C[C@H]1O)(O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-(-)-Quinic acid is a cyclohexanecarboxylic acid and is implicated in the perceived acidity of coffee. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 438.4±45.0 °C at 760 mmHg |
| Flash Point | 233.1±25.2 °C |
| Exact Mass | 192.063385 |
| PSA | 118.22000 |
| LogP | -2.01 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |