Home
Products
Triethyl citrate
| Product Name | Triethyl citrate |
| Price: | Inquiry |
| Catalog No.: | CN06333 |
| CAS No.: | 77-93-0 |
| Molecular Formula: | C12H20O7 |
| Molecular Weight: | 276.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Saccharum sinense |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)C(CC(=O)OCC)(CC(=O)OCC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triethyl citrate is an ester of citric acid. Triethyl citrate can be used as a plasticizer for cellulosic plastic-based nanocomposites[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 294.0±0.0 °C at 760 mmHg |
| Flash Point | 95.4±11.7 °C |
| Exact Mass | 276.120911 |
| PSA | 99.13000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | -20°C |