Home
Products
Tigogenin
| Product Name | Tigogenin |
| Price: | $46 / 20mg |
| Catalog No.: | CN02544 |
| CAS No.: | 77-60-1 |
| Molecular Formula: | C27H44O3 |
| Molecular Weight: | 416.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Agave sisalana Perrine |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@]2(OC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC[C@@H]3[C@]([C@H]1CC2)(C)CC[C@@H](C3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tigogenin, one of steroidal sapogenins, is widely used for synthesizing steroid drugs. Tigogenin inhibits adipocytic differentiation and induces osteoblastic differentiation in mouse bone marrow stromal cells[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 516.6±20.0 °C at 760 mmHg |
| Flash Point | 266.2±21.8 °C |
| Exact Mass | 416.329041 |
| PSA | 38.69000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |