Home
Products
Cedrol
| Product Name | Cedrol |
| Price: | $23 / 20mg |
| Catalog No.: | CN09019 |
| CAS No.: | 77-53-2 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The heartwoods from Juniperus virginiana L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@H]2[C@]31CC[C@@]([C@H](C3)C2(C)C)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cedrol is a bioactive sesquiterpene, a potent competitive inhibitor of cytochrome P-450 (CYP) enzymes. Cedrol inhibits CYP2B6-mediated bupropion hydroxylase and CYP3A4-mediated midazolam hydroxylation with Ki of 0.9 μM and 3.4 μM, respectively. Cedrol also has weak inhibitory effect on CYP2C8, CYP2C9, and CYP2C19 enzymes[1]. Cedrol is found in cedar essential oil and poetesses anti-septic, anti-inflammatory, anti-spasmodic, tonic, astringent, diuretic, sedative, insecticidal, and anti-fungal activities[2]. |
| Target | CYP2B6; CYP3A4; CYP2C8; CYP2C9; CYP2C19[1] |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 277.2±8.0 °C at 760 mmHg |
| Flash Point | 115.5±10.9 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 4.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |