Home
Products
Gibberellins
| Product Name | Gibberellins |
| Price: | $23 / 20mg |
| Catalog No.: | CN08821 |
| CAS No.: | 77-06-5 |
| Molecular Formula: | C19H22O6 |
| Molecular Weight: | 346.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | White powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@H]1[C@H]2[C@]3([C@H]4[C@]51CC(=C)[C@](C5)(O)CC4)C=C[C@@H]([C@@]2(C)C(=O)O3)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gibberellic Acid is named after a fungus Gibberella fujikuroi . Gibberellic Acid regulates processes of plant development and growth, including seed development and germination, stem and root growth, cell division, and flowering time[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 628.6±55.0 °C at 760 mmHg |
| Flash Point | 231.4±25.0 °C |
| Exact Mass | 346.141632 |
| PSA | 104.06000 |
| LogP | 0.01 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |