Home
Products
Garcinone C
| Product Name | Garcinone C |
| Price: | $146 / 5mg |
| Catalog No.: | CN05812 |
| CAS No.: | 76996-27-5 |
| Molecular Formula: | C23H26O7 |
| Molecular Weight: | 414.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)cc2c(c1O)c(=O)c1c(o2)cc(c(c1CCC(O)(C)C)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Garcinone C, a xanthone derivative, is a natural compound extracted from Garcinia oblongifolia Champ that is used as an anti-inflammatory, analgesia, astringency and granulation-promoting medicine, and has potential cytotoxic effects on certain cancers. Garcinone C stimulates the expression levels of ATR and 4E-BP1, while efficiently inhibiting the expression levels of cyclin B1, cyclin D1, cyclin E2, cdc2, Stat3 and CDK7. Garcinone C significantly inhibits cell viability of the human Nasopharyngeal carcinoma (NPC) cell lines CNE1, CNE2, HK1 and HONE1 in a time‑ and dose‑dependent manner[1]. |
| Target | ATR Stat-3 CDK7 |
| Density | 1.367 |
| Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Flash Point | 239.7±25.0 °C |
| Exact Mass | 414.167847 |
| PSA | 131.36000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |