Home
Products
Dihydrocurcumin
| Product Name | Dihydrocurcumin |
| Price: | $351 / 10mg |
| Catalog No.: | CN04114 |
| CAS No.: | 76474-56-1 |
| Molecular Formula: | C21H22O6 |
| Molecular Weight: | 370.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma longa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CCC(=O)/C=C(/C=C/c2ccc(c(c2)OC)O)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrocurcumin, a major metabolites of curcumin, reduces lipid accumulation and oxidative stress. Dihydrocurcumin regulates mRNA and protein expression levels of SREBP-1C, PNPLA3 and PPARα, increases protein expression levels of pAKT and PI3K, and reduced the levels of cellular NO and ROS via Nrf2 signaling pathways[1]. |
| Density | 1.277g/cm3 |
| Boiling Point | 616.3ºC at 760 mmHg |
| Flash Point | 217.8ºC |
| Exact Mass | 370.14200 |
| PSA | 96.22000 |
| LogP | 3.77200 |
| Storage condition | 2-8℃ |