Home
Products
Kuwanon H
| Product Name | Kuwanon H |
| Price: | $146 / 5mg |
| Catalog No.: | CN04811 |
| CAS No.: | 76472-87-2 |
| Molecular Formula: | C45H44O11 |
| Molecular Weight: | 760.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)ccc(c1O)C(=O)[C@H]1[C@@H](CC(=C[C@@H]1c1c(O)cc(c2c1oc(c1ccc(cc1O)O)c(c2=O)CC=C(C)C)O)C)c1ccc(cc1O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kuwanon H is a flavonoid isolated from Morus bombycis, which acts as a potent non-peptide bombesin receptor antagonist. Kuwanon H selectively inhibits binding of gastrin releasing peptide CRP to GRP-preferring recepotr, with a Ki value of 290 nM in cells[1]. |
| Target | Ki: 290 nM (GRP-preferring recepotr)[1] |
| Density | 1.371g/cm3 |
| Boiling Point | 969.8ºC at 760 mmHg |
| Flash Point | 292.5ºC |
| Exact Mass | 760.28800 |
| PSA | 209.12000 |
| LogP | 8.83870 |