Home
Products
Euphorbia factor L1
| Product Name | Euphorbia factor L1 |
| Price: | $103 / 20mg |
| Catalog No.: | CN08544 |
| CAS No.: | 76376-43-7 |
| Molecular Formula: | C32H40O8 |
| Molecular Weight: | 552.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Euphorbia pekinensis Rupr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(OC1C(C)CC2(C1C(OC(=O)C)C1(CCC3C(C=C(C2=O)C)C3(C)C)CO1)OC(=O)C)Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Euphorbia Factor L1 is a diterpenoid from Euphorbia lathyris L., reduces the expression of Bcl-2, PI3K, AKT and mTOR protein and mRNA, upregulates cleaved caspase-9 and caspase-3 levels, buts shows no effect on pro-caspase-9 and pro-caspase-3. Euphorbia Factor L1 induces apoptosis, has anticancer, antiadipogenesis, antiosteoclastogenesis and multidrug resistance-modulating effect[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 633.1±55.0 °C at 760 mmHg |
| Flash Point | 263.9±31.5 °C |
| Exact Mass | 552.272339 |
| PSA | 108.50000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8°C |