Home
Products
(1S)-(+)-Menthyl chloroformate
| Product Name | (1S)-(+)-Menthyl chloroformate |
| Price: | Inquiry |
| Catalog No.: | CN09677 |
| CAS No.: | 7635-54-3 |
| Molecular Formula: | C11H19ClO2 |
| Molecular Weight: | 218.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Mentha canadensis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)Cl)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 233.9±0.0 °C at 760 mmHg |
| Flash Point | 70.0±0.0 °C |
| Exact Mass | 218.107361 |
| PSA | 26.30000 |
| LogP | 4.83 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Storage condition | 2-8°C |