Home
Products
Polyphyllin G
| Product Name | Polyphyllin G |
| Price: | Inquiry |
| Catalog No.: | CN02564 |
| CAS No.: | 76296-75-8 |
| Molecular Formula: | C51H84O22 |
| Molecular Weight: | 1049.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Paris yunnanensis Franch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(=CCC4C3CCC3(C4CC4C3C(C)C(O4)(OC)CCC(COC3OC(CO)C(C(C3O)O)O)C)C)C2)C)C(C(C1OC1OC(C(C1O)O)CO)OC1OC(C)C(C(C1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polyphyllin G is isolated from the rhizomes of Paris yunnanensis, with antimicrobial and anticancer activity. Polyphyllin G prevents the growth of both Gram-positive and Gram-negative bacteria with minimum inhibitory concentrations (MICs)[1].Polyphyllin G induces apoptosis dependent on the activations of caspase-8, -3, and -9, induces autophagy[2]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1048.545410 |
| PSA | 335.06000 |
| LogP | 3.76 |