Home
Products
Glucosylvitexin
| Product Name | Glucosylvitexin |
| Price: | $77 / 20mg |
| Catalog No.: | CN05548 |
| CAS No.: | 76135-82-5 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Crataegus pinnatifida Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(O)cc(c3c2oc(cc3=O)c2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O.OC[C@H]1O[C@@H](O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4”-O-Glucosylvitexin is a bioactive flavonoid from leaves of Crataegus pinnatifida. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 947.3±65.0 °C at 760 mmHg |
| Flash Point | 314.7±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 260.20000 |
| LogP | -1.62 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |