Home
Products
1-Dehydro-6-gingerdione
| Product Name | 1-Dehydro-6-gingerdione |
| Price: | $394 / 5mg |
| Catalog No.: | CN03894 |
| CAS No.: | 76060-35-0 |
| Molecular Formula: | C17H22O4 |
| Molecular Weight: | 290.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Zingber officinale Rosc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCC(=O)CC(=O)/C=C/c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Dehydrogingerdione sensitizes human hepatoblastoma hep G2 cells to TRAIL-induced apoptosis via reactive oxygen species-mediated increase of DR5[1]. |
| In Vitro | 6-Dehydrogingerdione could trigger apoptotic cell death via both mitochondrial- and Fas receptor-mediated pathways[1]. 6-Dehydrogingerdione (6-DG) up-regulates Ser-15 phosphorylation and evoked p53 nuclear translocation[1]. 6-Dehydrogingerdione (6-DG) induces mitochondrial apoptotic pathway[1]. Apoptosis Analysis[1] Cell Line: Hep G2 cells. Concentration: 0, 50, 100 μM. Incubation Time: 24 h. Result: Induced Apoptosis in Hep G2 Cells. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 448.9±40.0 °C at 760 mmHg |
| Flash Point | 159.3±20.8 °C |
| Exact Mass | 290.15200 |
| PSA | 63.60000 |
| LogP | 3.52260 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |