Home
Products
Momordicoside A
| Product Name | Momordicoside A |
| Price: | $293 / 10mg |
| Catalog No.: | CN07254 |
| CAS No.: | 75801-95-5 |
| Molecular Formula: | C42H72O15 |
| Molecular Weight: | 817.02 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Mormodica charantia L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(O[C@H]3CC[C@@H]4C(=CC[C@@H]5[C@@]4(C)CC[C@]4([C@@]5(C)CC[C@@H]4[C@@H](C([C@H]([C@H](C(O)(C)C)O)O)O)C)C)C3(C)C)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Momordicoside A is isolated from Momordica charantia L. Momordicoside A has the inhibitory effect on protein tyrosine phosphatase (PTP1B)[1]. |
| Target | Protein tyrosine phosphatase[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 969.3±65.0 °C at 760 mmHg |
| Flash Point | 540.0±34.3 °C |
| Exact Mass | 816.487122 |
| PSA | 259.45000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |