Home
Products
Kuwanon G
| Product Name | Kuwanon G |
| Price: | $146 / 10mg |
| Catalog No.: | CN04501 |
| CAS No.: | 75629-19-5 |
| Molecular Formula: | C40H36O11 |
| Molecular Weight: | 692.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(oc2c(c1=O)c(O)cc(c2[C@H]1C=C(C)C[C@H]([C@@H]1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)O)c1ccc(cc1O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kuwanon G is a flavonoid isolated from Morus alba, acts as a bombesin receptor antagonist, with potential antimicrobial activity[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 942.4±65.0 °C at 760 mmHg |
| Flash Point | 293.9±27.8 °C |
| Exact Mass | 692.225769 |
| PSA | 209.12000 |
| LogP | 7.06 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |