Home
Products
Usnic acid
| Product Name | Usnic acid |
| Price: | Inquiry |
| Catalog No.: | CN03972 |
| CAS No.: | 7562-61-0 |
| Molecular Formula: | C18H16O7 |
| Molecular Weight: | 344.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Yellow powder |
| Source: | From usnea diffracta Vain. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)C1=C(O)[C@@]2(C(=CC1=O)Oc1c2c(O)c(C)c(c1C(=O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Usnic acid is isolated from isolated from lichens, binds at the ATP-binding pocket of mTOR, and inhibits mTORC1/2 activity. (+)-Usnic acid inhibits the phosphorylation of mTOR downstream effectors: Akt (Ser473), 4EBP1, S6K, induces autophay, with anti-cancer activity[1]. |
| Target | mTORC1 mTORC2 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 638.2±55.0 °C at 760 mmHg |
| Flash Point | 236.0±25.0 °C |
| Exact Mass | 344.089600 |
| PSA | 121.13000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | 2~8°C |