Home
Products
Kukoamine A
| Product Name | Kukoamine A |
| Price: | $321 / 10mg |
| Catalog No.: | CN01036 |
| CAS No.: | 75288-96-9 |
| Molecular Formula: | C28H42N4O6 |
| Molecular Weight: | 530.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The root barks of Lycium chinense |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CCc1ccc(c(c1)O)O)NCCCNCCCCNCCCNC(=O)CCc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kukoamine A is a natural occurring spermine derivative, acts as a potent inhibitor of trypanothione reductase (Ki, 1.8 μM), with antihypertensive activity[1]. |
| Target | Ki: 1.8 μM (Trypanothione reductase)[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 872.1±65.0 °C at 760 mmHg |
| Flash Point | 481.2±34.3 °C |
| Exact Mass | 530.310425 |
| PSA | 163.18000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |