Home
Products
Chikusetsusaponin IV
| Product Name | Chikusetsusaponin IV |
| Price: | $92 / 10mg |
| Catalog No.: | CN07627 |
| CAS No.: | 7518-22-1 |
| Molecular Formula: | C47H74O18 |
| Molecular Weight: | 927.08 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax japonicus C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@H](O[C@H]([C@@H]([C@H]1O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)C)C)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Araloside A (Chikusetsusaponin IV) is a component of Panax japonicus, with low-renin-inhibitory activity, with an IC50 of 77.4 μM[1]. |
| Target | IC50: 77.4 μM (Renin)[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 999.1±65.0 °C at 760 mmHg |
| Flash Point | 285.6±27.8 °C |
| Exact Mass | 926.487488 |
| PSA | 291.82000 |
| LogP | 7.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |