Home
Products
9-Methoxycanthin-6-one
| Product Name | 9-Methoxycanthin-6-one |
| Price: | Inquiry |
| Catalog No.: | CN01277 |
| CAS No.: | 74991-91-6 |
| Molecular Formula: | C15H10N2O2 |
| Molecular Weight: | 250.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Eurycoma longifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)n1c(=O)ccc3c1c2ccn3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 9-Methoxycanthin-6-one, a canthin-6-one alkaloid, is present in intact plant parts and in callus tissues of different explants. 9-Methoxycanthin-6-one shows anti-tumor activity[1][2]. |
| In Vitro | 9-Methoxycanthin-6-one is isolated from (Eurycoma longifolia Jack) Tongkat Ali Jack explants with emphasis on the tap and fibrous roots[1]. |
| Exact Mass | 250.07400 |
| PSA | 43.60000 |
| LogP | 2.44730 |