Home
Products
Methylophiopogonanone B
| Product Name | Methylophiopogonanone B |
| Price: | $103 / 5mg |
| Catalog No.: | CN05331 |
| CAS No.: | 74805-91-7 |
| Molecular Formula: | C19H20O5 |
| Molecular Weight: | 328.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Ophiopogon japonicus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)C[C@@H]1COc2c(C1=O)c(O)c(c(c2C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methylophiopogonanone B, homoisoflavonoid, is extracted from the root of Ophiopogon japonicas, shows high antioxidant ability[1]. Methylophiopogonanone B increases GTP-Rho and acts via the Rho signaling pathway, inducing cell morphological change via actin cytoskeletal reorganization, including dendrite retraction and stress fiber formation[2]. |
| Density | 1.285 |
| Boiling Point | 554.5±49.0 °C at 760 mmHg |
| Flash Point | 201.5±23.3 °C |
| Exact Mass | 328.131073 |
| PSA | 75.99000 |
| LogP | 5.22 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |