Home
Products
Liquiritin apioside
| Product Name | Liquiritin apioside |
| Price: | $190 / 10mg |
| Catalog No.: | CN04888 |
| CAS No.: | 74639-14-8 |
| Molecular Formula: | C26H30O13 |
| Molecular Weight: | 550.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)[C@@H]2CC(=O)c3c(O2)cc(cc3)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@]([C@H]1O)(O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Liquiritin apioside, a main flavonoid component of licorice, possesses antitussive effects[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 904.5±65.0 °C at 760 mmHg |
| Flash Point | 304.4±27.8 °C |
| Exact Mass | 550.168640 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |