Home
Products
8-Geranyloxypsoralen
| Product Name | 8-Geranyloxypsoralen |
| Price: | $293 / 10mg |
| Catalog No.: | CN06229 |
| CAS No.: | 7437-55-0 |
| Molecular Formula: | C21H22O4 |
| Molecular Weight: | 338.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Seseli mairei Wolff |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCOc1c2occc2cc2c1oc(=O)cc2)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Geranyloxypsoralen is a furanocoumarin isolated from grapefruit, acts as a potent inhibitor of P450 3A4 (CYP3A4) with an IC50 of 3.93 μM[1]. |
| Target | IC50: 3.93 μM (P450 3A4)[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 503.7±50.0 °C at 760 mmHg |
| Flash Point | 258.4±30.1 °C |
| Exact Mass | 338.151794 |
| PSA | 52.58000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |