Home
Products
Quercetin-3-gentiobioside
| Product Name | Quercetin-3-gentiobioside |
| Price: | $409 / 10mg |
| Catalog No.: | CN04828 |
| CAS No.: | 7431-83-6 |
| Molecular Formula: | C27H30O17 |
| Molecular Weight: | 626.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Solanum nigrum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3c(oc4c(c3=O)c(O)cc(c4)O)c3ccc(c(c3)O)O)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin 3-gentiobioside is isolated from A. iwayomogi, AR and AGE formation inhibitor, demonstrates biological activities against Aldose reductase (AR) and the formation of advanced glycation endproducts (AGEs)[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 1033.2±65.0 °C at 760 mmHg |
| Flash Point | 340.6±27.8 °C |
| Exact Mass | 626.148315 |
| PSA | 289.66000 |
| LogP | -0.73 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20℃ |