Home
Products
Kamebakaurin
| Product Name | Kamebakaurin |
| Price: | $293 / 10mg |
| Catalog No.: | CN08262 |
| CAS No.: | 73981-34-7 |
| Molecular Formula: | C20H30O5 |
| Molecular Weight: | 350.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia serra |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]12[C@@H](O)CCC([C@H]2C[C@H]([C@]23[C@H]1CC[C@H]([C@H]2O)C(=C)C3=O)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kamebakaurin is a natural compound isolated from Isodon japonicus. Kamebakaurin is a potent inhibitor of NF-κB activation by directly targeting DNA-binding activity of p50[1]. |
| Density | 1.3g/cm3 |
| Boiling Point | 563.5ºC at 760 mmHg |
| Flash Point | 308.6ºC |
| Exact Mass | 350.20900 |
| PSA | 97.99000 |
| LogP | 1.03920 |