Home
Products
Oxypeucedanin
| Product Name | Oxypeucedanin |
| Price: | $146 / 20mg |
| Catalog No.: | CN06202 |
| CAS No.: | 737-52-0 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | White powder |
| Source: | The roots of Angelica dahurica (Fisch. ex Hoffm) Benth. et Hook |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)cc1c(c2OCC2OC2(C)C)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oxypeucedanin is a furocoumarin derivative isolated from Angelica dahurica. Oxypeucedanin is a selective open-channel blocker, inhibits the hKv1.5 current with an IC50 value of 76 nM. Oxypeucedanin prolongs cardiac action potential duration (APD), is a potential antiarrhythmic agent for atrial fibrillation[1]. Oxypeucedanin induces cell apoptosis through inhibition of cancer cell migration[2]. |
| Target | IC50: HKv1.5 current; apoptosis[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 469.6±45.0 °C at 760 mmHg |
| Flash Point | 237.8±28.7 °C |
| Exact Mass | 286.084137 |
| PSA | 65.11000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |