Home
Products
Naringenin chalcone
| Product Name | Naringenin chalcone |
| Price: | $176 / 10mg |
| Catalog No.: | CN05643 |
| CAS No.: | 73692-50-9 |
| Molecular Formula: | C15H12O5 |
| Molecular Weight: | 272.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus maxima. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C=CC(=O)c1c(O)cc(cc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Naringenin chalcone is an intermediate in flavonol biosynthesis and is spontaneously metabolized into naringenin (NAR) by chalcone isomerase. Naringenin chalcone has anti-inflammatory and antiallergic activities[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 538.7±50.0 °C at 760 mmHg |
| Flash Point | 293.6±26.6 °C |
| Exact Mass | 272.068481 |
| PSA | 97.99000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | -20℃ |