Home
Products
Methylnissolin
| Product Name | Methylnissolin |
| Price: | $234 / 5mg |
| Catalog No.: | CN04809 |
| CAS No.: | 73340-41-7 |
| Molecular Formula: | C17H16O5 |
| Molecular Weight: | 300.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Astragalus sinicus L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1OC)O[C@@H]1[C@H]2COc2c1ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methylnissolin (Astrapterocarpan), isolated from Astragalus membranaceus, inhibits platelet-derived growth factor (PDGF)-BB-induced cell proliferation with an IC50 of 10 μM. Methylnissolin inhibits PDGF-BB-induced phosphorylation of extracellular signal-regulated kinase 1/2 (ERIC1/2) mitogen-activated protein (MAP) kinase. Methylnissolin inhibits PDGF-BB-induced vascular smooth muscle cell proliferation by inhibition of the ERK1/2 MAP kinase cascade[1]. |
| Target | PDGFR:10 μM (IC50) ERK1 ERK2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 428.9±45.0 °C at 760 mmHg |
| Flash Point | 213.2±28.7 °C |
| Exact Mass | 300.099762 |
| PSA | 57.15000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |