Home
Products
5-O-Caffeoylshikimic acid
| Product Name | 5-O-Caffeoylshikimic acid |
| Price: | $146 / 5mg |
| Catalog No.: | CN06818 |
| CAS No.: | 73263-62-4 |
| Molecular Formula: | C16H16O8 |
| Molecular Weight: | 336.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Illicium verum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(O[C@@H]1CC(=C[C@H]([C@H]1O)O)C(=O)O)/C=C/c1ccc(c(c1)OC(=O)C)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-O-Caffeoylshikimic acid can be used in the study for NSCLC[1][2]. |
| In Vitro | 5-O-cafeoylshikimic acid likely to be a key player to modulate NSCLC drug resistance in the near future[2]. |
| Exact Mass | 336.08500 |
| PSA | 144.52000 |
| LogP | 0.15930 |
| Storage condition | 2-8℃ |