Home
Products
(+)-Praeruptorin A
| Product Name | (+)-Praeruptorin A |
| Price: | Inquiry |
| Catalog No.: | CN06283 |
| CAS No.: | 73069-27-9 |
| Molecular Formula: | C22H22O8 |
| Molecular Weight: | 414.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Peucedanum praeruptorum Dunn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@H]1[C@@H](OC(=O)C)c2c(OC1(C)C)ccc1c2oc(=O)cc1)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Praeruptorin A is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin A exerts anti-inflammatory effects in vitro through inhibition of NF-κB activation[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 486.8±45.0 °C at 760 mmHg |
| Flash Point | 211.5±28.8 °C |
| Exact Mass | 386.136566 |
| PSA | 92.04000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |