Home
Products
Epigomisin O
| Product Name | Epigomisin O |
| Price: | $556 / 5mg |
| Catalog No.: | CN02810 |
| CAS No.: | 73036-31-4 |
| Molecular Formula: | C23H28O7 |
| Molecular Weight: | 416.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C(O)C(C)C(C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epigomisin O is isolate from the fruits of Schisandra plants[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 575.6±50.0 °C at 760 mmHg |
| Flash Point | 301.9±30.1 °C |
| Exact Mass | 416.183502 |
| PSA | 75.61000 |
| LogP | 4.81 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |