Home
Products
L-Isoleucine
| Product Name | L-Isoleucine |
| Price: | $12 / 20mg |
| Catalog No.: | CN00085 |
| CAS No.: | 73-32-5 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@H]([C@@H](C(=O)O)N)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Isoleucine is one of 20 proteinogenic amino acids. L-Isoleucine is an essential amino acid. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 225.8±23.0 °C at 760 mmHg |
| Flash Point | 90.3±22.6 °C |
| Exact Mass | 131.094635 |
| PSA | 63.32000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |