Home
Products
(+)-Catechin hydrate
| Product Name | (+)-Catechin hydrate |
| Price: | Inquiry |
| Catalog No.: | CN05523 |
| CAS No.: | 7295-85-4 |
| Molecular Formula: | C15H14O6.H2O |
| Molecular Weight: | 308.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | White powder |
| Source: | The barks of Taxus yunnanensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2OC(c3ccc(c(c3)O)O)C(Cc2c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (±)-Catechin (rel-Cianidanol) is the racemate of Catechin. (±)-Catechin has two steric forms of (+)-Catechin and its enantiomer (-)-Catechin. (+)-Catechin inhibits cyclooxygenase-1 (COX-1) with an IC50 of 1.4 μM. Anticancer, anti-obesity, antidiabetic, anticardiovascular, anti-infectious, hepatoprotective, and neuroprotective effects[1]. |
| Exact Mass | 308.089600 |
| PSA | 119.61000 |
| LogP | 1.48180 |
| Storage condition | 2-8°C |