Home
Products
Benzoyloxypeoniflorin
| Product Name | Benzoyloxypeoniflorin |
| Price: | $161 / 10mg |
| Catalog No.: | CN09644 |
| CAS No.: | 72896-40-3 |
| Molecular Formula: | C30H32O13 |
| Molecular Weight: | 600.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1C(O[C@@H]([C@H]([C@@H]1O)O)COC(=O)c1ccccc1)O[C@@]12C[C@@H]3[C@@]2(COC(=O)c2ccc(cc2)O)[C@@H]2O[C@@]1(C)C[C@]3(O2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzoyloxypaeoniflorin, isolated from the root of Paeonia suffruticosa, is a tyrosinase inhibitor against mushroom tyrosinase with IC50 of 0.453 mM. Benzoyloxypaeoniflorin is NF-κB Inhibitor and contributes to improving blood circulation through its inhibitory effect on both platelet aggregation and blood coagulation[1][2][3]. |
| Target | IC50: 0.453 mM (Mushroom tyrosinase)[1] NF-κB[2] |
| Density | 1.6±0.0 g/cm3 |
| Boiling Point | 789.1±0.0 °C at 760 mmHg |
| Flash Point | 258.6±0.0 °C |
| Exact Mass | 600.184265 |
| PSA | 190.67000 |
| LogP | 5.22 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Storage condition | 2-8℃ |