Home
Products
Deoxyartemisinin
| Product Name | Deoxyartemisinin |
| Price: | Inquiry |
| Catalog No.: | CN09395 |
| CAS No.: | 72826-63-2 |
| Molecular Formula: | C15H22O4 |
| Molecular Weight: | 266.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia annua L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@H]2[C@@]34[C@H]1CC[C@@](O3)(O[C@H]4OC(=O)[C@@H]2C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deoxy artemisinin, a orally bioavailable compound separated from Artemisinin annua L., shows anti-inflammatory and antiulcer activities[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 387.9±37.0 °C at 760 mmHg |
| Flash Point | 171.5±26.5 °C |
| Exact Mass | 266.151794 |
| PSA | 44.76000 |
| LogP | 2.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | -20°C Freezer |