Home
Products
Paeonolide
| Product Name | Paeonolide |
| Price: | $219 / 20mg |
| Catalog No.: | CN03763 |
| CAS No.: | 72520-92-4 |
| Molecular Formula: | C20H28O12 |
| Molecular Weight: | 460.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(c(c1)O[C@@H]1O[C@H](CO[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)C(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Paeonolide is a plant glycoside that contains a non-reducing end α-l-arabinopyranoside and is found in the roots of the widespread plant genus Paeonia[1]. |
| Density | 1.54±0.1 g/cm3 |
| Boiling Point | 749.7±60.0 °C at 760 mmHg |
| Flash Point | 261.2±26.4 °C |
| Exact Mass | 460.158081 |
| PSA | 184.60000 |
| LogP | 0.04 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |