Home
Products
Ungeremine
| Product Name | Ungeremine |
| Price: | $117 / 20mg |
| Catalog No.: | CN00774 |
| CAS No.: | 72510-04-4 |
| Molecular Formula: | C16H12NO3+ |
| Molecular Weight: | 266.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbus of Lycoris radiata (L. Herit.) Herb |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2CC[n+]3c2c(c1)c1cc2OCOc2cc1c3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 266.081177 |
| Storage condition | 2-8C |